C15H15N5O2 — CID 58935827
3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]-N-pyridin-2-ylpropanamide (PubChem CID 58935827) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 58935827 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-[(3-oxo-1,2-dihydroindazol-6-yl)amino]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(CCNc1ccc2c(=O)[nH][nH]c2c1)Nc1ccccn1 |
| InChI | InChI=1S/C15H15N5O2/c21-14(18-13-3-1-2-7-17-13)6-8-16-10-4-5-11-12(9-10)19-20-15(11)22/h1-5,7,9,16H,6,8H2,(H,17,18,21)(H2,19,20,22) |
| InChIKey | RUUARDIOFIOWQX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |