C19H23IN2O5S — CID 58936512
tert-butyl 2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoate (PubChem CID 58936512) has the molecular formula C19H23IN2O5S and a molecular weight of 518.37 g/mol. Its IUPAC name is tert-butyl 2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoate.
| Compound Name | tert-butyl 2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoate |
|---|---|
| PubChem CID | 58936512 |
| Molecular Formula | C19H23IN2O5S |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | tert-butyl 2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)n1cccc(NS(=O)(=O)Cc2ccc(I)cc2)c1=O |
| InChI | InChI=1S/C19H23IN2O5S/c1-13(18(24)27-19(2,3)4)22-11-5-6-16(17(22)23)21-28(25,26)12-14-7-9-15(20)10-8-14/h5-11,13,21H,12H2,1-4H3 |
| InChIKey | BLEJIFMFYIOJIJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|