C15H15IN2O5S — CID 58936521
(2S)-2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoic acid (PubChem CID 58936521) has the molecular formula C15H15IN2O5S and a molecular weight of 462.27 g/mol. Its IUPAC name is (2S)-2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoic acid.
| Compound Name | (2S)-2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 58936521 |
| Molecular Formula | C15H15IN2O5S |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | (2S)-2-[3-[(4-iodophenyl)methylsulfonylamino]-2-oxo-1-pyridinyl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)n1cccc(NS(=O)(=O)Cc2ccc(I)cc2)c1=O |
| InChI | InChI=1S/C15H15IN2O5S/c1-10(15(20)21)18-8-2-3-13(14(18)19)17-24(22,23)9-11-4-6-12(16)7-5-11/h2-8,10,17H,9H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | UPKJBOSXQRYDJL-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|