C31H34N6O4S — CID 10218630
2-[3-(benzylsulfonylamino)-2-oxo-6-(2-phenylethyl)-1-pyridinyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]propanamide (PubChem CID 10218630) has the molecular formula C31H34N6O4S and a molecular weight of 586.72 g/mol. Its IUPAC name is 2-[3-(benzylsulfonylamino)-2-oxo-6-(2-phenylethyl)-1-pyridinyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]propanamide.
| Compound Name | 2-[3-(benzylsulfonylamino)-2-oxo-6-(2-phenylethyl)-1-pyridinyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 10218630 |
| Molecular Formula | C31H34N6O4S |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 2-[3-(benzylsulfonylamino)-2-oxo-6-(2-phenylethyl)-1-pyridinyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]propanamide |
| SMILES | CC(C(=O)NCc1ccc(N=C(N)N)cc1)n1c(CCc2ccccc2)ccc(NS(=O)(=O)Cc2ccccc2)c1=O |
| InChI | InChI=1S/C31H34N6O4S/c1-22(29(38)34-20-24-12-15-26(16-13-24)35-31(32)33)37-27(17-14-23-8-4-2-5-9-23)18-19-28(30(37)39)36-42(40,41)21-25-10-6-3-7-11-25/h2-13,15-16,18-19,22,36H,14,17,20-21H2,1H3,(H,34,38)(H4,32,33,35) |
| InChIKey | DHCZPMJMGWPRPA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|