C21H28N6O6S — CID 11752233
(2R)-N-[2-[[4-[[amino-(hydroxyamino)methylidene]amino]phenyl]methylamino]-2-oxoethyl]-2-(benzylsulfonylamino)-3-hydroxy-N-methylpropanamide (PubChem CID 11752233) has the molecular formula C21H28N6O6S and a molecular weight of 492.56 g/mol. Its IUPAC name is (2R)-N-[2-[[4-[[amino-(hydroxyamino)methylidene]amino]phenyl]methylamino]-2-oxoethyl]-2-(benzylsulfonylamino)-3-hydroxy-N-methylpropanamide.
| Compound Name | (2R)-N-[2-[[4-[[amino-(hydroxyamino)methylidene]amino]phenyl]methylamino]-2-oxoethyl]-2-(benzylsulfonylamino)-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 11752233 |
| Molecular Formula | C21H28N6O6S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (2R)-N-[2-[[4-[[amino-(hydroxyamino)methylidene]amino]phenyl]methylamino]-2-oxoethyl]-2-(benzylsulfonylamino)-3-hydroxy-N-methylpropanamide |
| SMILES | CN(CC(=O)NCc1ccc(/N=C(\N)NO)cc1)C(=O)[C@@H](CO)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H28N6O6S/c1-27(12-19(29)23-11-15-7-9-17(10-8-15)24-21(22)25-31)20(30)18(13-28)26-34(32,33)14-16-5-3-2-4-6-16/h2-10,18,26,28,31H,11-14H2,1H3,(H,23,29)(H3,22,24,25)/t18-/m1/s1 |
| InChIKey | DIVDRJHGYBLNAR-GOSISDBHSA-N |
| XLogP | -0.83 |
| TPSA | 186.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|