C19H27ClN6O6S2 — CID 25051796
2-(benzylsulfonylamino)-N-[2-[[4-(diaminomethylideneamino)phenyl]sulfonylamino]ethyl]-3-hydroxypropanamide;hydrochloride (PubChem CID 25051796) has the molecular formula C19H27ClN6O6S2 and a molecular weight of 535.05 g/mol. Its IUPAC name is 2-(benzylsulfonylamino)-N-[2-[[4-(diaminomethylideneamino)phenyl]sulfonylamino]ethyl]-3-hydroxypropanamide;hydrochloride.
| Compound Name | 2-(benzylsulfonylamino)-N-[2-[[4-(diaminomethylideneamino)phenyl]sulfonylamino]ethyl]-3-hydroxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 25051796 |
| Molecular Formula | C19H27ClN6O6S2 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 2-(benzylsulfonylamino)-N-[2-[[4-(diaminomethylideneamino)phenyl]sulfonylamino]ethyl]-3-hydroxypropanamide;hydrochloride |
| SMILES | Cl.NC(N)=Nc1ccc(S(=O)(=O)NCCNC(=O)C(CO)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26N6O6S2.ClH/c20-19(21)24-15-6-8-16(9-7-15)33(30,31)23-11-10-22-18(27)17(12-26)25-32(28,29)13-14-4-2-1-3-5-14;/h1-9,17,23,25-26H,10-13H2,(H,22,27)(H4,20,21,24);1H |
| InChIKey | OVMMSSAXEILYLJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|