C19H28N6O5S — CID 10297770
(2R)-N-[(2S)-1-[3-(2-amino-1H-imidazol-5-yl)propylamino]-1-oxopropan-2-yl]-2-(benzylsulfonylamino)-3-hydroxypropanamide (PubChem CID 10297770) has the molecular formula C19H28N6O5S and a molecular weight of 452.54 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[3-(2-amino-1H-imidazol-5-yl)propylamino]-1-oxopropan-2-yl]-2-(benzylsulfonylamino)-3-hydroxypropanamide.
| Compound Name | (2R)-N-[(2S)-1-[3-(2-amino-1H-imidazol-5-yl)propylamino]-1-oxopropan-2-yl]-2-(benzylsulfonylamino)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 10297770 |
| Molecular Formula | C19H28N6O5S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2R)-N-[(2S)-1-[3-(2-amino-1H-imidazol-5-yl)propylamino]-1-oxopropan-2-yl]-2-(benzylsulfonylamino)-3-hydroxypropanamide |
| SMILES | C[C@H](NC(=O)[C@@H](CO)NS(=O)(=O)Cc1ccccc1)C(=O)NCCCc1cnc(N)[nH]1 |
| InChI | InChI=1S/C19H28N6O5S/c1-13(17(27)21-9-5-8-15-10-22-19(20)24-15)23-18(28)16(11-26)25-31(29,30)12-14-6-3-2-4-7-14/h2-4,6-7,10,13,16,25-26H,5,8-9,11-12H2,1H3,(H,21,27)(H,23,28)(H3,20,22,24)/t13-,16+/m0/s1 |
| InChIKey | BHSRMFNXKDXSDE-XJKSGUPXSA-N |
| XLogP | -0.97 |
| TPSA | 179.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|