C33H40N6O9S — CID 10190250
benzyl N-[N'-[4-[[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate (PubChem CID 10190250) has the molecular formula C33H40N6O9S and a molecular weight of 696.78 g/mol. Its IUPAC name is benzyl N-[N'-[4-[[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[4-[[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 10190250 |
| Molecular Formula | C33H40N6O9S |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | benzyl N-[N'-[4-[[(2S)-2-[[(2R)-2-(benzylsulfonylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate |
| SMILES | C[C@H](NC(=O)[C@@H](CO)NS(=O)(=O)Cc1ccccc1)C(=O)NCCCC/N=C(\NC(=O)OCc1ccccc1)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C33H40N6O9S/c1-24(36-30(42)28(21-40)39-49(45,46)23-26-15-7-3-8-16-26)29(41)34-19-11-12-20-35-31(38-33(44)48-27-17-9-4-10-18-27)37-32(43)47-22-25-13-5-2-6-14-25/h2-10,13-18,24,28,39-40H,11-12,19-23H2,1H3,(H,34,41)(H,36,42)(H2,35,37,38,43,44)/t24-,28+/m0/s1 |
| InChIKey | SZMYLLSODAWZGS-RBJSKKJNSA-N |
| XLogP | 1.94 |
| TPSA | 213.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|