C35H45N3O8S — CID 70002045
benzyl N-[(2S)-3-methyl-1-[[2-oxo-1-phenoxy-7-(phenylmethoxycarbonylamino)heptan-3-yl]sulfamoyl]pentan-2-yl]carbamate (PubChem CID 70002045) has the molecular formula C35H45N3O8S and a molecular weight of 667.83 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-[[2-oxo-1-phenoxy-7-(phenylmethoxycarbonylamino)heptan-3-yl]sulfamoyl]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-[[2-oxo-1-phenoxy-7-(phenylmethoxycarbonylamino)heptan-3-yl]sulfamoyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70002045 |
| Molecular Formula | C35H45N3O8S |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-[[2-oxo-1-phenoxy-7-(phenylmethoxycarbonylamino)heptan-3-yl]sulfamoyl]pentan-2-yl]carbamate |
| SMILES | CCC(C)[C@@H](CS(=O)(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)COc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H45N3O8S/c1-3-27(2)32(37-35(41)46-24-29-17-9-5-10-18-29)26-47(42,43)38-31(33(39)25-44-30-19-11-6-12-20-30)21-13-14-22-36-34(40)45-23-28-15-7-4-8-16-28/h4-12,15-20,27,31-32,38H,3,13-14,21-26H2,1-2H3,(H,36,40)(H,37,41)/t27?,31?,32-/m1/s1 |
| InChIKey | WQVMLZZHGGPBOB-TYEMOSCHSA-N |
| XLogP | 5.36 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|