C18H20N2O2 — CID 58936964
(4R,4aR,7S,12bS)-9-isocyano-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 58936964) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (4R,4aR,7S,12bS)-9-isocyano-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aR,7S,12bS)-9-isocyano-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 58936964 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (4R,4aR,7S,12bS)-9-isocyano-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | [C-]#[N+]c1ccc2c3c1OC1[C@@H](O)CC[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H20N2O2/c1-19-12-5-3-10-9-13-11-4-6-14(21)17-18(11,7-8-20(13)2)15(10)16(12)22-17/h3,5,11,13-14,17,21H,4,6-9H2,2H3/t11-,13+,14-,17?,18-/m0/s1 |
| InChIKey | AYGGFPJDLHJOJR-HMXJVSSTSA-N |
| XLogP | 2.27 |
| TPSA | 37.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|