C15H24O7 — CID 58940486
[(3R,4R,5S,7R)-2,3-diacetyloxy-7-ethyl-5-methyloxepan-4-yl] acetate (PubChem CID 58940486) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is [(3R,4R,5S,7R)-2,3-diacetyloxy-7-ethyl-5-methyloxepan-4-yl] acetate.
| Compound Name | [(3R,4R,5S,7R)-2,3-diacetyloxy-7-ethyl-5-methyloxepan-4-yl] acetate |
|---|---|
| PubChem CID | 58940486 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(3R,4R,5S,7R)-2,3-diacetyloxy-7-ethyl-5-methyloxepan-4-yl] acetate |
| SMILES | CC[C@@H]1C[C@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)O1 |
| InChI | InChI=1S/C15H24O7/c1-6-12-7-8(2)13(19-9(3)16)14(20-10(4)17)15(22-12)21-11(5)18/h8,12-15H,6-7H2,1-5H3/t8-,12+,13+,14+,15?/m0/s1 |
| InChIKey | BBODWTSOOIHTGP-ZELHWBEASA-N |
| XLogP | 1.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|