C21H28N6O3 — CID 58944983
5-amino-7-[3-(1-amino-2-isocyano-2-methylpropyl)pyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione (PubChem CID 58944983) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-amino-7-[3-(1-amino-2-isocyano-2-methylpropyl)pyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione.
| Compound Name | 5-amino-7-[3-(1-amino-2-isocyano-2-methylpropyl)pyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 58944983 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 5-amino-7-[3-(1-amino-2-isocyano-2-methylpropyl)pyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione |
| SMILES | [C-]#[N+]C(C)(C)C(N)C1CCN(c2cc(N)c3c(=O)[nH]c(=O)n(C4CC4)c3c2OC)C1 |
| InChI | InChI=1S/C21H28N6O3/c1-21(2,24-3)18(23)11-7-8-26(10-11)14-9-13(22)15-16(17(14)30-4)27(12-5-6-12)20(29)25-19(15)28/h9,11-12,18H,5-8,10,22-23H2,1-2,4H3,(H,25,28,29) |
| InChIKey | RAWWECGMKYEMET-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|