C19H21AsN4O3 — CID 87898589
CID 87898589 (PubChem CID 87898589) has the molecular formula C19H21AsN4O3 and a molecular weight of 428.32 g/mol.
| Compound Name | CID 87898589 |
|---|---|
| PubChem CID | 87898589 |
| Molecular Formula | C19H21AsN4O3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | — |
| SMILES | COc1c(N2CCC(C([As])CC#N)C2)ccc2c(=O)[nH]c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C19H21AsN4O3/c1-27-17-15(23-9-7-11(10-23)14(20)6-8-21)5-4-13-16(17)24(12-2-3-12)19(26)22-18(13)25/h4-5,11-12,14H,2-3,6-7,9-10H2,1H3,(H,22,25,26) |
| InChIKey | GBEIMZIEGURFJR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|