C12H14BrClN2O4 — CID 58946757
methyl (2R)-2-[(2-bromo-5-chloro-4-methoxyphenyl)carbamoylamino]propanoate (PubChem CID 58946757) has the molecular formula C12H14BrClN2O4 and a molecular weight of 365.61 g/mol. Its IUPAC name is methyl (2R)-2-[(2-bromo-5-chloro-4-methoxyphenyl)carbamoylamino]propanoate.
| Compound Name | methyl (2R)-2-[(2-bromo-5-chloro-4-methoxyphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 58946757 |
| Molecular Formula | C12H14BrClN2O4 |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | methyl (2R)-2-[(2-bromo-5-chloro-4-methoxyphenyl)carbamoylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)Nc1cc(Cl)c(OC)cc1Br |
| InChI | InChI=1S/C12H14BrClN2O4/c1-6(11(17)20-3)15-12(18)16-9-5-8(14)10(19-2)4-7(9)13/h4-6H,1-3H3,(H2,15,16,18)/t6-/m1/s1 |
| InChIKey | OOCMHRQKNWUBAZ-ZCFIWIBFSA-N |
| XLogP | 2.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |