C16H15ClF3NO2S — CID 58950225
2-(4-chlorophenyl)sulfonyl-N,N-dimethyl-2-(2,3,6-trifluorophenyl)ethanamine (PubChem CID 58950225) has the molecular formula C16H15ClF3NO2S and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N,N-dimethyl-2-(2,3,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N,N-dimethyl-2-(2,3,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 58950225 |
| Molecular Formula | C16H15ClF3NO2S |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N,N-dimethyl-2-(2,3,6-trifluorophenyl)ethanamine |
| SMILES | CN(C)CC(c1c(F)ccc(F)c1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClF3NO2S/c1-21(2)9-14(15-12(18)7-8-13(19)16(15)20)24(22,23)11-5-3-10(17)4-6-11/h3-8,14H,9H2,1-2H3 |
| InChIKey | XTNSWFFFAFESNX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|