C28H39N3O4S — CID 58950808
N-(3,5-dimethoxyphenyl)-4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidine-1-carbothioamide (PubChem CID 58950808) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidine-1-carbothioamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 58950808 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidine-1-carbothioamide |
| SMILES | COc1ccc(C2CCN(CC(O)C3CCN(C(=S)Nc4cc(OC)cc(OC)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H39N3O4S/c1-33-24-6-4-20(5-7-24)21-8-12-30(13-9-21)19-27(32)22-10-14-31(15-11-22)28(36)29-23-16-25(34-2)18-26(17-23)35-3/h4-7,16-18,21-22,27,32H,8-15,19H2,1-3H3,(H,29,36) |
| InChIKey | NQKGYCRHWDBZGS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|