C29H38N2O3 — CID 69407253
1-[4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one (PubChem CID 69407253) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 1-[4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69407253 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 1-[4-[1-hydroxy-2-[4-(4-methoxyphenyl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C2CCN(CC(O)C3CCN(C(=O)C=Cc4cccc(C)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H38N2O3/c1-22-4-3-5-23(20-22)6-11-29(33)31-18-14-26(15-19-31)28(32)21-30-16-12-25(13-17-30)24-7-9-27(34-2)10-8-24/h3-11,20,25-26,28,32H,12-19,21H2,1-2H3 |
| InChIKey | FRWKHZBFKMLLPA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|