C20H26O5 — CID 58952614
(13R)-11,12-dihydroxy-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 58952614) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (13R)-11,12-dihydroxy-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | (13R)-11,12-dihydroxy-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 58952614 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (13R)-11,12-dihydroxy-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | C[C@@]12C(=O)CCC1C1CCC3=CC4(CCC3=C1C(O)C2O)OCCO4 |
| InChI | InChI=1S/C20H26O5/c1-19-14(4-5-15(19)21)13-3-2-11-10-20(24-8-9-25-20)7-6-12(11)16(13)17(22)18(19)23/h10,13-14,17-18,22-23H,2-9H2,1H3/t13?,14?,17?,18?,19-/m0/s1 |
| InChIKey | VACZYFGWUFUEAQ-ZOHRLJIISA-N |
| XLogP | 1.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |