C20H24O4 — CID 169439831
[(2S,4R,5S,6S,9S,10S)-5-methyl-15-oxo-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadeca-1(18),13-dien-6-yl] acetate (PubChem CID 169439831) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2S,4R,5S,6S,9S,10S)-5-methyl-15-oxo-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadeca-1(18),13-dien-6-yl] acetate.
| Compound Name | [(2S,4R,5S,6S,9S,10S)-5-methyl-15-oxo-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadeca-1(18),13-dien-6-yl] acetate |
|---|---|
| PubChem CID | 169439831 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [(2S,4R,5S,6S,9S,10S)-5-methyl-15-oxo-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadeca-1(18),13-dien-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H]3O[C@@H]3[C@]12C |
| InChI | InChI=1S/C20H24O4/c1-10(21)23-16-8-7-15-14-5-3-11-9-12(22)4-6-13(11)17(14)18-19(24-18)20(15,16)2/h9,14-16,18-19H,3-8H2,1-2H3/t14-,15-,16-,18-,19-,20-/m0/s1 |
| InChIKey | MZOTWTGGHOAXKP-GJCUDGATSA-N |
| XLogP | 3.11 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|