C16H16F6O2 — CID 58952836
2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione (PubChem CID 58952836) has the molecular formula C16H16F6O2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione.
| Compound Name | 2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione |
|---|---|
| PubChem CID | 58952836 |
| Molecular Formula | C16H16F6O2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-fluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione |
| SMILES | CCCCCCCC(=O)C(F)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H16F6O2/c1-2-3-4-5-6-7-8(23)10(17)16(24)9-11(18)13(20)15(22)14(21)12(9)19/h10H,2-7H2,1H3 |
| InChIKey | NKRCLNMDJHCBJB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|