C12H10F3NO4 — CID 58955791
ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)pyridine-2-carboxylate (PubChem CID 58955791) has the molecular formula C12H10F3NO4 and a molecular weight of 289.21 g/mol. Its IUPAC name is ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)pyridine-2-carboxylate.
| Compound Name | ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58955791 |
| Molecular Formula | C12H10F3NO4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | ethyl 4-(4,4,4-trifluoro-3-oxobutanoyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)CC(=O)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C12H10F3NO4/c1-2-20-11(19)8-5-7(3-4-16-8)9(17)6-10(18)12(13,14)15/h3-5H,2,6H2,1H3 |
| InChIKey | IIQLNOZKVRUGQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|