C11H6Br2F3NOS — CID 58956218
5-bromo-2-(bromomethyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazole (PubChem CID 58956218) has the molecular formula C11H6Br2F3NOS and a molecular weight of 417.04 g/mol. Its IUPAC name is 5-bromo-2-(bromomethyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazole.
| Compound Name | 5-bromo-2-(bromomethyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 58956218 |
| Molecular Formula | C11H6Br2F3NOS |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 414.85 |
| IUPAC Name | 5-bromo-2-(bromomethyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)Oc1ccc(-c2nc(CBr)sc2Br)cc1 |
| InChI | InChI=1S/C11H6Br2F3NOS/c12-5-8-17-9(10(13)19-8)6-1-3-7(4-2-6)18-11(14,15)16/h1-4H,5H2 |
| InChIKey | ROMGQVXJBUCIIZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|