C35H29N3 — CID 58957698
(2Z)-2-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 58957698) has the molecular formula C35H29N3 and a molecular weight of 491.64 g/mol. Its IUPAC name is (2Z)-2-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58957698 |
| Molecular Formula | C35H29N3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (2Z)-2-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C2C=C(c3ccc(N4c5ccccc5C=Cc5ccccc54)cc3)CCC2C(C)(C)C1 |
| InChI | InChI=1S/C35H29N3/c1-35(2)22-29(32(23-36)37-3)21-28-20-27(16-19-31(28)35)24-14-17-30(18-15-24)38-33-10-6-4-8-25(33)12-13-26-9-5-7-11-34(26)38/h4-15,17-18,20-21,31H,16,19,22H2,1-2H3/b32-29+ |
| InChIKey | JBKPUXLOBCUDJB-UUDCSCGESA-N |
| XLogP | 9.49 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|