About (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium
(6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium (PubChem CID 58960944) has the molecular formula C6H4N2Y-2
and a molecular weight of 193.02 g/mol. Its IUPAC name is (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium.
Molecular Properties
| Compound Name | (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium |
| PubChem CID | 58960944 |
| Molecular Formula | C6H4N2Y-2 |
| Molecular Weight | 193.02 g/mol |
| Exact Mass | 192.94 |
| IUPAC Name | (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium |
| SMILES | [N-]=C1C=CC=CC1=[N-].[Y] |
| InChI | InChI=1S/C6H4N2.Y/c7-5-3-1-2-4-6(5)8;/h1-4H;/q-2; |
| InChIKey | YAZVZHMEUJVAGE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.02 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium?
The IUPAC name of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium (CID 58960944) is (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium.
What is the SMILES notation for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium?
The canonical SMILES for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium is [N-]=C1C=CC=CC1=[N-].[Y].
What is the InChIKey of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium?
The InChIKey is YAZVZHMEUJVAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2.Y/c7-5-3-1-2-4-6(5)8;/h1-4H;/q-2;.
What are the key properties of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium?
(6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium has a molecular weight of 193.02 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;yttrium is sourced from PubChem (CID 58960944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).