C16H15NOS — CID 58961344
N-(10-methylidene-9H-thioxanthen-3-yl)acetamide (PubChem CID 58961344) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(10-methylidene-9H-thioxanthen-3-yl)acetamide.
| Compound Name | N-(10-methylidene-9H-thioxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 58961344 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(10-methylidene-9H-thioxanthen-3-yl)acetamide |
| SMILES | C=S1c2ccccc2Cc2ccc(NC(C)=O)cc21 |
| InChI | InChI=1S/C16H15NOS/c1-11(18)17-14-8-7-13-9-12-5-3-4-6-15(12)19(2)16(13)10-14/h3-8,10H,2,9H2,1H3,(H,17,18) |
| InChIKey | RTMYIKPNRNIYJA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|