C21H24O4S2 — CID 58966089
[(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methyl] acetate (PubChem CID 58966089) has the molecular formula C21H24O4S2 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methyl] acetate.
| Compound Name | [(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methyl] acetate |
|---|---|
| PubChem CID | 58966089 |
| Molecular Formula | C21H24O4S2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(3,5-dimethoxyphenyl)-(2-phenyl-1,3-dithian-2-yl)methyl] acetate |
| SMILES | COc1cc(OC)cc(C(OC(C)=O)C2(c3ccccc3)SCCCS2)c1 |
| InChI | InChI=1S/C21H24O4S2/c1-15(22)25-20(16-12-18(23-2)14-19(13-16)24-3)21(26-10-7-11-27-21)17-8-5-4-6-9-17/h4-6,8-9,12-14,20H,7,10-11H2,1-3H3 |
| InChIKey | ABOYWONHSMBXCM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |