C6H9O2W3- — CID 58974959
hexane-1,5-dione;tungsten (PubChem CID 58974959) has the molecular formula C6H9O2W3- and a molecular weight of 664.66 g/mol. Its IUPAC name is hexane-1,5-dione;tungsten.
| Compound Name | hexane-1,5-dione;tungsten |
|---|---|
| PubChem CID | 58974959 |
| Molecular Formula | C6H9O2W3- |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 664.91 |
| IUPAC Name | hexane-1,5-dione;tungsten |
| SMILES | CC(=O)CCC[C-]=O.[W].[W].[W] |
| InChI | InChI=1S/C6H9O2.3W/c1-6(8)4-2-3-5-7;;;/h2-4H2,1H3;;;/q-1;;; |
| InChIKey | WZKIDVMXWHDWOC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|