C28H35N9O3 — CID 58976646
1-(6-anilino-2-methylpyrimidin-4-yl)-3-N-[3-methoxy-4-(4-morpholin-4-ylbutoxy)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 58976646) has the molecular formula C28H35N9O3 and a molecular weight of 545.65 g/mol. Its IUPAC name is 1-(6-anilino-2-methylpyrimidin-4-yl)-3-N-[3-methoxy-4-(4-morpholin-4-ylbutoxy)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(6-anilino-2-methylpyrimidin-4-yl)-3-N-[3-methoxy-4-(4-morpholin-4-ylbutoxy)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976646 |
| Molecular Formula | C28H35N9O3 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 1-(6-anilino-2-methylpyrimidin-4-yl)-3-N-[3-methoxy-4-(4-morpholin-4-ylbutoxy)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cc(Nc2nc(N)n(-c3cc(Nc4ccccc4)nc(C)n3)n2)ccc1OCCCCN1CCOCC1 |
| InChI | InChI=1S/C28H35N9O3/c1-20-30-25(32-21-8-4-3-5-9-21)19-26(31-20)37-27(29)34-28(35-37)33-22-10-11-23(24(18-22)38-2)40-15-7-6-12-36-13-16-39-17-14-36/h3-5,8-11,18-19H,6-7,12-17H2,1-2H3,(H,30,31,32)(H3,29,33,34,35) |
| InChIKey | WBIIAULIKLMVFZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|