C9H17N3O — CID 58984551
9-methyl-1,3,9-triazaspiro[5.5]undecan-2-one (PubChem CID 58984551) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 9-methyl-1,3,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 9-methyl-1,3,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 58984551 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 9-methyl-1,3,9-triazaspiro[5.5]undecan-2-one |
| SMILES | CN1CCC2(CCNC(=O)N2)CC1 |
| InChI | InChI=1S/C9H17N3O/c1-12-6-3-9(4-7-12)2-5-10-8(13)11-9/h2-7H2,1H3,(H2,10,11,13) |
| InChIKey | BEQRJNGGLJLVQA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |