C31H33ClN4O10S — CID 58984624
2-[3-chloro-4-[4-[2-[2-methoxyethyl-(2-nitrophenyl)sulfonylamino]ethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate (PubChem CID 58984624) has the molecular formula C31H33ClN4O10S and a molecular weight of 689.14 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[2-[2-methoxyethyl-(2-nitrophenyl)sulfonylamino]ethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate.
| Compound Name | 2-[3-chloro-4-[4-[2-[2-methoxyethyl-(2-nitrophenyl)sulfonylamino]ethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 58984624 |
| Molecular Formula | C31H33ClN4O10S |
| Molecular Weight | 689.14 g/mol |
| Exact Mass | 688.16 |
| IUPAC Name | 2-[3-chloro-4-[4-[2-[2-methoxyethyl-(2-nitrophenyl)sulfonylamino]ethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate |
| SMILES | COCCN(CCN1Cc2ccccc2N(C(=O)c2ccc(OCCOC(C)=O)cc2Cl)CC1=O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H33ClN4O10S/c1-22(37)45-17-18-46-24-11-12-25(26(32)19-24)31(39)35-21-30(38)33(20-23-7-3-4-8-27(23)35)13-14-34(15-16-44-2)47(42,43)29-10-6-5-9-28(29)36(40)41/h3-12,19H,13-18,20-21H2,1-2H3 |
| InChIKey | HTZOTYMQODORPR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 165.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|