C29H34ClN5O8 — CID 69349026
2-[3-chloro-4-[4-[2-[2-(3-morpholin-4-ylpropanoyl)hydrazinyl]-2-oxoethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate (PubChem CID 69349026) has the molecular formula C29H34ClN5O8 and a molecular weight of 616.07 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[2-[2-(3-morpholin-4-ylpropanoyl)hydrazinyl]-2-oxoethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate.
| Compound Name | 2-[3-chloro-4-[4-[2-[2-(3-morpholin-4-ylpropanoyl)hydrazinyl]-2-oxoethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 69349026 |
| Molecular Formula | C29H34ClN5O8 |
| Molecular Weight | 616.07 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 2-[3-chloro-4-[4-[2-[2-(3-morpholin-4-ylpropanoyl)hydrazinyl]-2-oxoethyl]-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(C(=O)N2CC(=O)N(CC(=O)NNC(=O)CCN3CCOCC3)Cc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C29H34ClN5O8/c1-20(36)42-14-15-43-22-6-7-23(24(30)16-22)29(40)35-19-28(39)34(17-21-4-2-3-5-25(21)35)18-27(38)32-31-26(37)8-9-33-10-12-41-13-11-33/h2-7,16H,8-15,17-19H2,1H3,(H,31,37)(H,32,38) |
| InChIKey | JKCATUYERGYPHO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|