C14H10N2O2 — CID 589883
2-anilino-3,1-benzoxazin-4-one (PubChem CID 589883) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-anilino-3,1-benzoxazin-4-one.
| Compound Name | 2-anilino-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 589883 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-anilino-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(Nc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C14H10N2O2/c17-13-11-8-4-5-9-12(11)16-14(18-13)15-10-6-2-1-3-7-10/h1-9H,(H,15,16) |
| InChIKey | UUMLXNZZKFQMMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |