C17H21FO2 — CID 58991871
(9bS)-7-ethoxy-6-fluoro-3-[(Z)-prop-1-enyl]-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 58991871) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is (9bS)-7-ethoxy-6-fluoro-3-[(Z)-prop-1-enyl]-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | (9bS)-7-ethoxy-6-fluoro-3-[(Z)-prop-1-enyl]-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 58991871 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (9bS)-7-ethoxy-6-fluoro-3-[(Z)-prop-1-enyl]-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | C/C=C\C1CC[C@H]2c3ccc(OCC)c(F)c3OC2C1 |
| InChI | InChI=1S/C17H21FO2/c1-3-5-11-6-7-12-13-8-9-14(19-4-2)16(18)17(13)20-15(12)10-11/h3,5,8-9,11-12,15H,4,6-7,10H2,1-2H3/b5-3-/t11?,12-,15?/m0/s1 |
| InChIKey | RQFHBVIQPDDGTD-SNJJGMRWSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|