C31H36F2O5 — CID 157296922
(9bS)-3-ethenyl-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran;(9bS)-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran-3-carbaldehyde (PubChem CID 157296922) has the molecular formula C31H36F2O5 and a molecular weight of 526.62 g/mol. Its IUPAC name is (9bS)-3-ethenyl-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran;(9bS)-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran-3-carbaldehyde.
| Compound Name | (9bS)-3-ethenyl-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran;(9bS)-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 157296922 |
| Molecular Formula | C31H36F2O5 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (9bS)-3-ethenyl-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran;(9bS)-7-ethoxy-6-fluoro-1,2,3,4,4a,9b-hexahydrodibenzofuran-3-carbaldehyde |
| SMILES | C=CC1CC[C@H]2c3ccc(OCC)c(F)c3OC2C1.CCOc1ccc2c(c1F)OC1CC(C=O)CC[C@@H]21 |
| InChI | InChI=1S/C16H19FO2.C15H17FO3/c1-3-10-5-6-11-12-7-8-13(18-4-2)15(17)16(12)19-14(11)9-10;1-2-18-12-6-5-11-10-4-3-9(8-17)7-13(10)19-15(11)14(12)16/h3,7-8,10-11,14H,1,4-6,9H2,2H3;5-6,8-10,13H,2-4,7H2,1H3/t10?,11-,14?;9?,10-,13?/m00/s1 |
| InChIKey | BBLKRRASQPGUIY-OKHNWHRTSA-N |
| XLogP | 7.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|