About 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide
3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide (PubChem CID 58994512) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide |
| PubChem CID | 58994512 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide |
| SMILES | CC1(C)CC=C(c2cc(CCC(N)=O)ccc2N)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-17(2)9-7-13(8-10-17)14-11-12(3-5-15(14)18)4-6-16(19)20/h3,5,7,11H,4,6,8-10,18H2,1-2H3,(H2,19,20) |
| InChIKey | LRIYOBUFTFKVJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide?
The IUPAC name of 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide (CID 58994512) is 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide.
What is the SMILES notation for 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide?
The canonical SMILES for 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide is CC1(C)CC=C(c2cc(CCC(N)=O)ccc2N)CC1.
What is the InChIKey of 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide?
The InChIKey is LRIYOBUFTFKVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-17(2)9-7-13(8-10-17)14-11-12(3-5-15(14)18)4-6-16(19)20/h3,5,7,11H,4,6,8-10,18H2,1-2H3,(H2,19,20).
What are the key properties of 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide?
3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide has a molecular weight of 272.39 g/mol, XLogP of 3.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide is sourced from PubChem (CID 58994512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).