C17H24N2O — CID 58994512
3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide (PubChem CID 58994512) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide.
| Compound Name | 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 58994512 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]propanamide |
| SMILES | CC1(C)CC=C(c2cc(CCC(N)=O)ccc2N)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-17(2)9-7-13(8-10-17)14-11-12(3-5-15(14)18)4-6-16(19)20/h3,5,7,11H,4,6,8-10,18H2,1-2H3,(H2,19,20) |
| InChIKey | LRIYOBUFTFKVJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|