C24H35N5O7S4 — CID 58996068
3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonic acid (PubChem CID 58996068) has the molecular formula C24H35N5O7S4 and a molecular weight of 633.84 g/mol. Its IUPAC name is 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58996068 |
| Molecular Formula | C24H35N5O7S4 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 3-[2-oxo-4,6-bis(sulfanylidene)-3-(3-sulfopropyl)-5-[2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1C(=CC=C2C(=S)N(CCCS(=O)(=O)O)C(=O)N(CCCS(=O)(=O)O)C2=S)N(CC)c2c1cc(C)n2CC |
| InChI | InChI=1S/C24H35N5O7S4/c1-5-25-17(4)16-19-21(25)27(7-3)20(26(19)6-2)11-10-18-22(37)28(12-8-14-39(31,32)33)24(30)29(23(18)38)13-9-15-40(34,35)36/h10-11,16H,5-9,12-15H2,1-4H3,(H,31,32,33)(H,34,35,36) |
| InChIKey | ZOSLZXBSFUXVEP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|