C9H15N3S — CID 58997919
5-but-3-enyl-4-ethyl-1-methyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 58997919) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-but-3-enyl-4-ethyl-1-methyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 5-but-3-enyl-4-ethyl-1-methyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 58997919 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-but-3-enyl-4-ethyl-1-methyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | C=CCCc1n(C)nc([S-])[n+]1CC |
| InChI | InChI=1S/C9H15N3S/c1-4-6-7-8-11(3)10-9(13)12(8)5-2/h4H,1,5-7H2,2-3H3 |
| InChIKey | STNNXULDGLFYOS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|