C30H47N4O3S+ — CID 59000273
[4-[5-(dibutylamino)peroxysulfanyl-2,3-dihydroindol-1-yl]-2-octoxyphenyl]iminoazanium (PubChem CID 59000273) has the molecular formula C30H47N4O3S+ and a molecular weight of 543.80 g/mol. Its IUPAC name is [4-[5-(dibutylamino)peroxysulfanyl-2,3-dihydroindol-1-yl]-2-octoxyphenyl]iminoazanium.
| Compound Name | [4-[5-(dibutylamino)peroxysulfanyl-2,3-dihydroindol-1-yl]-2-octoxyphenyl]iminoazanium |
|---|---|
| PubChem CID | 59000273 |
| Molecular Formula | C30H47N4O3S+ |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | [4-[5-(dibutylamino)peroxysulfanyl-2,3-dihydroindol-1-yl]-2-octoxyphenyl]iminoazanium |
| SMILES | CCCCCCCCOc1cc(N2CCc3cc(SOON(CCCC)CCCC)ccc32)ccc1N=[NH2+] |
| InChI | InChI=1S/C30H46N4O3S/c1-4-7-10-11-12-13-22-35-30-24-26(14-16-28(30)32-31)34-21-18-25-23-27(15-17-29(25)34)38-37-36-33(19-8-5-2)20-9-6-3/h14-17,23-24,31H,4-13,18-22H2,1-3H3/p+1 |
| InChIKey | ZELGIJXCCZPQPZ-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|