C13H30OSi2 — CID 590052
(3,5-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane (PubChem CID 590052) has the molecular formula C13H30OSi2 and a molecular weight of 258.55 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane.
| Compound Name | (3,5-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane |
|---|---|
| PubChem CID | 590052 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3,5-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane |
| SMILES | CC1CC(C)CC(O[Si](C)(C)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H30OSi2/c1-11-8-12(2)10-13(9-11)14-16(6,7)15(3,4)5/h11-13H,8-10H2,1-7H3 |
| InChIKey | HGOAXQLRUXOMMW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|