C15H30OSi — CID 575611
1-(3,5-dimethylcyclohexyl)oxy-1-ethylsilinane (PubChem CID 575611) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)oxy-1-ethylsilinane.
| Compound Name | 1-(3,5-dimethylcyclohexyl)oxy-1-ethylsilinane |
|---|---|
| PubChem CID | 575611 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)oxy-1-ethylsilinane |
| SMILES | CC[Si]1(OC2CC(C)CC(C)C2)CCCCC1 |
| InChI | InChI=1S/C15H30OSi/c1-4-17(8-6-5-7-9-17)16-15-11-13(2)10-14(3)12-15/h13-15H,4-12H2,1-3H3 |
| InChIKey | AKFPPGLOZYCERQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|