C13H18O2 — CID 59014969
2,3,3,3-tetradeuterio-2-[4-[3,3,3-trideuterio-2-(trideuteriomethyl)propyl]phenyl]propanoic acid (PubChem CID 59014969) has the molecular formula C13H18O2 and a molecular weight of 216.35 g/mol. Its IUPAC name is 2,3,3,3-tetradeuterio-2-[4-[3,3,3-trideuterio-2-(trideuteriomethyl)propyl]phenyl]propanoic acid.
| Compound Name | 2,3,3,3-tetradeuterio-2-[4-[3,3,3-trideuterio-2-(trideuteriomethyl)propyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59014969 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2,3,3,3-tetradeuterio-2-[4-[3,3,3-trideuterio-2-(trideuteriomethyl)propyl]phenyl]propanoic acid |
| SMILES | [2H]C([2H])([2H])C(Cc1ccc(C([2H])(C(=O)O)C([2H])([2H])[2H])cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/i1D3,2D3,3D3,10D |
| InChIKey | HEFNNWSXXWATRW-CGDOGRBOSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |