C9H11Cl3F3NO2SSi — CID 59017049
1,1,1-trifluoro-N-[(6-trichlorosilyl-2-bicyclo[2.2.1]hept-5-enyl)methyl]methanesulfonamide (PubChem CID 59017049) has the molecular formula C9H11Cl3F3NO2SSi and a molecular weight of 388.70 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(6-trichlorosilyl-2-bicyclo[2.2.1]hept-5-enyl)methyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(6-trichlorosilyl-2-bicyclo[2.2.1]hept-5-enyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 59017049 |
| Molecular Formula | C9H11Cl3F3NO2SSi |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 1,1,1-trifluoro-N-[(6-trichlorosilyl-2-bicyclo[2.2.1]hept-5-enyl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(NCC1CC2C=C([Si](Cl)(Cl)Cl)C1C2)C(F)(F)F |
| InChI | InChI=1S/C9H11Cl3F3NO2SSi/c10-20(11,12)8-3-5-1-6(7(8)2-5)4-16-19(17,18)9(13,14)15/h3,5-7,16H,1-2,4H2 |
| InChIKey | ZRJHZNBGPNTPPN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|