C38H32N2O3S — CID 59018528
methyl (2S)-2-[(5-phenyl-1,3-oxazol-2-yl)amino]-3-(4-tritylsulfanylphenyl)propanoate (PubChem CID 59018528) has the molecular formula C38H32N2O3S and a molecular weight of 596.75 g/mol. Its IUPAC name is methyl (2S)-2-[(5-phenyl-1,3-oxazol-2-yl)amino]-3-(4-tritylsulfanylphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(5-phenyl-1,3-oxazol-2-yl)amino]-3-(4-tritylsulfanylphenyl)propanoate |
|---|---|
| PubChem CID | 59018528 |
| Molecular Formula | C38H32N2O3S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | methyl (2S)-2-[(5-phenyl-1,3-oxazol-2-yl)amino]-3-(4-tritylsulfanylphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)Nc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C38H32N2O3S/c1-42-36(41)34(40-37-39-27-35(43-37)29-14-6-2-7-15-29)26-28-22-24-33(25-23-28)44-38(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25,27,34H,26H2,1H3,(H,39,40)/t34-/m0/s1 |
| InChIKey | FFXBCQHRZMYQSB-UMSFTDKQSA-N |
| XLogP | 8.62 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|