C20H15ClN4O2S — CID 59026024
2-(4-chlorophenyl)-3-(2-methyl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59026024) has the molecular formula C20H15ClN4O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-methyl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(2-methyl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59026024 |
| Molecular Formula | C20H15ClN4O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-methyl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | Cc1nc(C(=O)N2CCN3C(=O)c4ccncc4C23c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C20H15ClN4O2S/c1-12-23-17(11-28-12)19(27)25-9-8-24-18(26)15-6-7-22-10-16(15)20(24,25)13-2-4-14(21)5-3-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | QNNNVDVJFMEXNT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |