About 2-methanidyl-N-phenylaniline;tetrakis(yttrium)
2-methanidyl-N-phenylaniline;tetrakis(yttrium) (PubChem CID 59026767) has the molecular formula C13H12NY4-
and a molecular weight of 537.87 g/mol. Its IUPAC name is 2-methanidyl-N-phenylaniline;tetrakis(yttrium).
Molecular Properties
| Compound Name | 2-methanidyl-N-phenylaniline;tetrakis(yttrium) |
| PubChem CID | 59026767 |
| Molecular Formula | C13H12NY4- |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 537.72 |
| IUPAC Name | 2-methanidyl-N-phenylaniline;tetrakis(yttrium) |
| SMILES | [CH2-]c1ccccc1Nc1ccccc1.[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C13H12N.4Y/c1-11-7-5-6-10-13(11)14-12-8-3-2-4-9-12;;;;/h2-10,14H,1H2;;;;/q-1;;;; |
| InChIKey | WQSAAGFKVDQBMI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidyl-N-phenylaniline;tetrakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidyl-N-phenylaniline;tetrakis(yttrium)?
The IUPAC name of 2-methanidyl-N-phenylaniline;tetrakis(yttrium) (CID 59026767) is 2-methanidyl-N-phenylaniline;tetrakis(yttrium).
What is the SMILES notation for 2-methanidyl-N-phenylaniline;tetrakis(yttrium)?
The canonical SMILES for 2-methanidyl-N-phenylaniline;tetrakis(yttrium) is [CH2-]c1ccccc1Nc1ccccc1.[Y].[Y].[Y].[Y].
What is the InChIKey of 2-methanidyl-N-phenylaniline;tetrakis(yttrium)?
The InChIKey is WQSAAGFKVDQBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N.4Y/c1-11-7-5-6-10-13(11)14-12-8-3-2-4-9-12;;;;/h2-10,14H,1H2;;;;/q-1;;;;.
What are the key properties of 2-methanidyl-N-phenylaniline;tetrakis(yttrium)?
2-methanidyl-N-phenylaniline;tetrakis(yttrium) has a molecular weight of 537.87 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidyl-N-phenylaniline;tetrakis(yttrium) is sourced from PubChem (CID 59026767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).