C23H25N3O2 — CID 59031501
(E)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide (PubChem CID 59031501) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031501 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (E)-N-[(2R)-1-amino-1-oxopropan-2-yl]-3-[4-(1H-indol-4-yl)-2,5-dimethylphenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(C)c(-c2cccc3[nH]ccc23)cc1C)C(=O)N[C@H](C)C(N)=O |
| InChI | InChI=1S/C23H25N3O2/c1-13-12-20(18-6-5-7-21-19(18)8-9-25-21)14(2)10-17(13)11-15(3)23(28)26-16(4)22(24)27/h5-12,16,25H,1-4H3,(H2,24,27)(H,26,28)/b15-11+/t16-/m1/s1 |
| InChIKey | ILFIFDOUBWWUCQ-RBFDBLARSA-N |
| XLogP | 3.85 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|