C13H14N2O2 — CID 59034212
5-methylidene-2,6-dioxo-1-prop-2-enyl-4-propylpyridine-3-carbonitrile (PubChem CID 59034212) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-methylidene-2,6-dioxo-1-prop-2-enyl-4-propylpyridine-3-carbonitrile.
| Compound Name | 5-methylidene-2,6-dioxo-1-prop-2-enyl-4-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59034212 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5-methylidene-2,6-dioxo-1-prop-2-enyl-4-propylpyridine-3-carbonitrile |
| SMILES | C=CCN1C(=O)C(=C)C(CCC)=C(C#N)C1=O |
| InChI | InChI=1S/C13H14N2O2/c1-4-6-10-9(3)12(16)15(7-5-2)13(17)11(10)8-14/h5H,2-4,6-7H2,1H3 |
| InChIKey | UOXVBYOAUOXZGP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|