C14H15N2OS+ — CID 59035342
4-(5-methylidene-4-phenyl-1,3-thiazol-2-ylidene)morpholin-4-ium (PubChem CID 59035342) has the molecular formula C14H15N2OS+ and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(5-methylidene-4-phenyl-1,3-thiazol-2-ylidene)morpholin-4-ium.
| Compound Name | 4-(5-methylidene-4-phenyl-1,3-thiazol-2-ylidene)morpholin-4-ium |
|---|---|
| PubChem CID | 59035342 |
| Molecular Formula | C14H15N2OS+ |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-(5-methylidene-4-phenyl-1,3-thiazol-2-ylidene)morpholin-4-ium |
| SMILES | C=C1SC(=[N+]2CCOCC2)N=C1c1ccccc1 |
| InChI | InChI=1S/C14H15N2OS/c1-11-13(12-5-3-2-4-6-12)15-14(18-11)16-7-9-17-10-8-16/h2-6H,1,7-10H2/q+1 |
| InChIKey | APHYZGFGCUNZEK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|