C25H36N8O4 — CID 59035889
(2R,3R,4S,5R)-2-[2-[[[1-(benzylamino)piperidin-4-yl]amino]methyl]-6-(methylamino)purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 59035889) has the molecular formula C25H36N8O4 and a molecular weight of 512.62 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-[[[1-(benzylamino)piperidin-4-yl]amino]methyl]-6-(methylamino)purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-[[[1-(benzylamino)piperidin-4-yl]amino]methyl]-6-(methylamino)purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59035889 |
| Molecular Formula | C25H36N8O4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-[[[1-(benzylamino)piperidin-4-yl]amino]methyl]-6-(methylamino)purin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | CNc1nc(CNC2CCN(NCc3ccccc3)CC2)nc2c1ncn2[C@@H]1O[C@H](COC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H36N8O4/c1-26-23-20-24(33(15-28-20)25-22(35)21(34)18(37-25)14-36-2)31-19(30-23)13-27-17-8-10-32(11-9-17)29-12-16-6-4-3-5-7-16/h3-7,15,17-18,21-22,25,27,29,34-35H,8-14H2,1-2H3,(H,26,30,31)/t18-,21-,22-,25-/m1/s1 |
| InChIKey | BKLYGHSVYHTXQW-PXOHRUDZSA-N |
| XLogP | 0.39 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |