C14H26N2O3 — CID 59040980
2-methylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate (PubChem CID 59040980) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-methylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate.
| Compound Name | 2-methylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
|---|---|
| PubChem CID | 59040980 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-methylpropyl (NZ)-N-(2,2-dimethyl-1-morpholin-4-ylpropylidene)carbamate |
| SMILES | CC(C)COC(=O)/N=C(\N1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-11(2)10-19-13(17)15-12(14(3,4)5)16-6-8-18-9-7-16/h11H,6-10H2,1-5H3/b15-12- |
| InChIKey | JFANLXORZHQUGJ-QINSGFPZSA-N |
| XLogP | 2.56 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|